C14H12ClNO3 — CID 104963016
(1S,6R)-6-(7-chloro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104963016) has the molecular formula C14H12ClNO3 and a molecular weight of 277.71 g/mol. Its IUPAC name is (1S,6R)-6-(7-chloro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(7-chloro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104963016 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | (1S,6R)-6-(7-chloro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1c1nc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C14H12ClNO3/c15-10-6-3-7-11-12(10)19-13(16-11)8-4-1-2-5-9(8)14(17)18/h1-3,6-9H,4-5H2,(H,17,18)/t8-,9+/m1/s1 |
| InChIKey | KYMOBUGXQTZRNW-BDAKNGLRSA-N |
| XLogP | 3.62 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|