C14H11ClFNO3 — CID 82720239
6-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 82720239) has the molecular formula C14H11ClFNO3 and a molecular weight of 295.70 g/mol. Its IUPAC name is 6-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 82720239 |
| Molecular Formula | C14H11ClFNO3 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 6-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1c1nc2cc(Cl)c(F)cc2o1 |
| InChI | InChI=1S/C14H11ClFNO3/c15-9-5-11-12(6-10(9)16)20-13(17-11)7-3-1-2-4-8(7)14(18)19/h1-2,5-8H,3-4H2,(H,18,19) |
| InChIKey | ZFWUASSWFKNXMQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|