ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate

C11H10ClNO3 — CID 894114

IUPACethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate
SMILESCCOC(=O)Cc1nc2cc(Cl)ccc2o1
InChIInChI=1S/C11H10ClNO3/c1-2-15-11(14)6-10-13-8-5-7(12)3-4-9(8)16-10/h3-5H,2,6H2,1H3
InChIKeyLIDLQLJDBGDIFT-UHFFFAOYSA-N
MW239.66 g/mol
LogP2.59
Rot. Bonds3

About ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate

ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate (PubChem CID 894114) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate.

Molecular Properties

Compound Nameethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate
PubChem CID894114
Molecular FormulaC11H10ClNO3
Molecular Weight239.66 g/mol
Exact Mass239.03
IUPAC Nameethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate
SMILESCCOC(=O)Cc1nc2cc(Cl)ccc2o1
InChIInChI=1S/C11H10ClNO3/c1-2-15-11(14)6-10-13-8-5-7(12)3-4-9(8)16-10/h3-5H,2,6H2,1H3
InChIKeyLIDLQLJDBGDIFT-UHFFFAOYSA-N
XLogP2.59
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.66
LogP ≤ 52.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate?
The IUPAC name of ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate (CID 894114) is ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate.
What is the SMILES notation for ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate?
The canonical SMILES for ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate is CCOC(=O)Cc1nc2cc(Cl)ccc2o1.
What is the InChIKey of ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate?
The InChIKey is LIDLQLJDBGDIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO3/c1-2-15-11(14)6-10-13-8-5-7(12)3-4-9(8)16-10/h3-5H,2,6H2,1H3.
What are the key properties of ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate?
ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate has a molecular weight of 239.66 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate is sourced from PubChem (CID 894114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).