C13H16N2OS — CID 82905095
5-ethyl-2-thiomorpholin-3-yl-1,3-benzoxazole (PubChem CID 82905095) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 5-ethyl-2-thiomorpholin-3-yl-1,3-benzoxazole.
| Compound Name | 5-ethyl-2-thiomorpholin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82905095 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-ethyl-2-thiomorpholin-3-yl-1,3-benzoxazole |
| SMILES | CCc1ccc2oc(C3CSCCN3)nc2c1 |
| InChI | InChI=1S/C13H16N2OS/c1-2-9-3-4-12-10(7-9)15-13(16-12)11-8-17-6-5-14-11/h3-4,7,11,14H,2,5-6,8H2,1H3 |
| InChIKey | SOGKLLKBLGGDDI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |