C12H14N2O2 — CID 82230801
5-methoxy-2-pyrrolidin-2-yl-1,3-benzoxazole (PubChem CID 82230801) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-methoxy-2-pyrrolidin-2-yl-1,3-benzoxazole.
| Compound Name | 5-methoxy-2-pyrrolidin-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82230801 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 5-methoxy-2-pyrrolidin-2-yl-1,3-benzoxazole |
| SMILES | COc1ccc2oc(C3CCCN3)nc2c1 |
| InChI | InChI=1S/C12H14N2O2/c1-15-8-4-5-11-10(7-8)14-12(16-11)9-3-2-6-13-9/h4-5,7,9,13H,2-3,6H2,1H3 |
| InChIKey | IPZIGCCBKPYMOO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |