C12H14N2O3 — CID 102697022
4-(5-methoxy-1,3-benzoxazol-2-yl)oxolan-3-amine (PubChem CID 102697022) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-(5-methoxy-1,3-benzoxazol-2-yl)oxolan-3-amine.
| Compound Name | 4-(5-methoxy-1,3-benzoxazol-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 102697022 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-(5-methoxy-1,3-benzoxazol-2-yl)oxolan-3-amine |
| SMILES | COc1ccc2oc(C3COCC3N)nc2c1 |
| InChI | InChI=1S/C12H14N2O3/c1-15-7-2-3-11-10(4-7)14-12(17-11)8-5-16-6-9(8)13/h2-4,8-9H,5-6,13H2,1H3 |
| InChIKey | BOQSTUUYZWNJBV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |