C14H18N2O2 — CID 82622741
1-(5-methoxy-1,3-benzoxazol-2-yl)cyclohexan-1-amine (PubChem CID 82622741) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(5-methoxy-1,3-benzoxazol-2-yl)cyclohexan-1-amine.
| Compound Name | 1-(5-methoxy-1,3-benzoxazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 82622741 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(5-methoxy-1,3-benzoxazol-2-yl)cyclohexan-1-amine |
| SMILES | COc1ccc2oc(C3(N)CCCCC3)nc2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-17-10-5-6-12-11(9-10)16-13(18-12)14(15)7-3-2-4-8-14/h5-6,9H,2-4,7-8,15H2,1H3 |
| InChIKey | IWOZDGKTVNVIIO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |