C12H11F3N2O — CID 81198454
1-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]cyclobutan-1-amine (PubChem CID 81198454) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]cyclobutan-1-amine.
| Compound Name | 1-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 81198454 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]cyclobutan-1-amine |
| SMILES | NC1(c2nc3cc(C(F)(F)F)ccc3o2)CCC1 |
| InChI | InChI=1S/C12H11F3N2O/c13-12(14,15)7-2-3-9-8(6-7)17-10(18-9)11(16)4-1-5-11/h2-3,6H,1,4-5,16H2 |
| InChIKey | VCRKKJWLJGVXMH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |