C18H21NOS — CID 54573694
2-(6-ethylnaphthalen-2-yl)-1-thiomorpholin-3-ylethanone (PubChem CID 54573694) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-(6-ethylnaphthalen-2-yl)-1-thiomorpholin-3-ylethanone.
| Compound Name | 2-(6-ethylnaphthalen-2-yl)-1-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 54573694 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(6-ethylnaphthalen-2-yl)-1-thiomorpholin-3-ylethanone |
| SMILES | CCc1ccc2cc(CC(=O)C3CSCCN3)ccc2c1 |
| InChI | InChI=1S/C18H21NOS/c1-2-13-3-5-16-10-14(4-6-15(16)9-13)11-18(20)17-12-21-8-7-19-17/h3-6,9-10,17,19H,2,7-8,11-12H2,1H3 |
| InChIKey | ZZBWBCIWWDEDOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |