C12H13Cl2NOS — CID 116609447
2-(2,4-dichlorophenyl)-1-thiomorpholin-3-ylethanone (PubChem CID 116609447) has the molecular formula C12H13Cl2NOS and a molecular weight of 290.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-thiomorpholin-3-ylethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 116609447 |
| Molecular Formula | C12H13Cl2NOS |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-thiomorpholin-3-ylethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)C1CSCCN1 |
| InChI | InChI=1S/C12H13Cl2NOS/c13-9-2-1-8(10(14)6-9)5-12(16)11-7-17-4-3-15-11/h1-2,6,11,15H,3-5,7H2 |
| InChIKey | DAMDHWGHTKNFAI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |