C14H18ClNO2S — CID 116586447
1-(5-chloro-2-methoxyphenyl)-3-thiomorpholin-3-ylpropan-2-one (PubChem CID 116586447) has the molecular formula C14H18ClNO2S and a molecular weight of 299.82 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-thiomorpholin-3-ylpropan-2-one.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-thiomorpholin-3-ylpropan-2-one |
|---|---|
| PubChem CID | 116586447 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-thiomorpholin-3-ylpropan-2-one |
| SMILES | COc1ccc(Cl)cc1CC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C14H18ClNO2S/c1-18-14-3-2-11(15)6-10(14)7-13(17)8-12-9-19-5-4-16-12/h2-3,6,12,16H,4-5,7-9H2,1H3 |
| InChIKey | VFQQRDAVCVQWHE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |