About 3-(1,2-dihydropyridin-6-yl)thiomorpholine
3-(1,2-dihydropyridin-6-yl)thiomorpholine (PubChem CID 173113888) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is 3-(1,2-dihydropyridin-6-yl)thiomorpholine.
Molecular Properties
| Compound Name | 3-(1,2-dihydropyridin-6-yl)thiomorpholine |
| PubChem CID | 173113888 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-(1,2-dihydropyridin-6-yl)thiomorpholine |
| SMILES | C1=CCNC(C2CSCCN2)=C1 |
| InChI | InChI=1S/C9H14N2S/c1-2-4-10-8(3-1)9-7-12-6-5-11-9/h1-3,9-11H,4-7H2 |
| InChIKey | WCJYTYGJGLOBKE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,2-dihydropyridin-6-yl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dihydropyridin-6-yl)thiomorpholine?
The IUPAC name of 3-(1,2-dihydropyridin-6-yl)thiomorpholine (CID 173113888) is 3-(1,2-dihydropyridin-6-yl)thiomorpholine.
What is the SMILES notation for 3-(1,2-dihydropyridin-6-yl)thiomorpholine?
The canonical SMILES for 3-(1,2-dihydropyridin-6-yl)thiomorpholine is C1=CCNC(C2CSCCN2)=C1.
What is the InChIKey of 3-(1,2-dihydropyridin-6-yl)thiomorpholine?
The InChIKey is WCJYTYGJGLOBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S/c1-2-4-10-8(3-1)9-7-12-6-5-11-9/h1-3,9-11H,4-7H2.
What are the key properties of 3-(1,2-dihydropyridin-6-yl)thiomorpholine?
3-(1,2-dihydropyridin-6-yl)thiomorpholine has a molecular weight of 182.29 g/mol, XLogP of 0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dihydropyridin-6-yl)thiomorpholine is sourced from PubChem (CID 173113888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).