C7H10N2O3S — CID 82397158
5-hydroxy-4-thiomorpholin-3-yl-1,2-oxazol-3-one (PubChem CID 82397158) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 5-hydroxy-4-thiomorpholin-3-yl-1,2-oxazol-3-one.
| Compound Name | 5-hydroxy-4-thiomorpholin-3-yl-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 82397158 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-hydroxy-4-thiomorpholin-3-yl-1,2-oxazol-3-one |
| SMILES | O=c1[nH]oc(O)c1C1CSCCN1 |
| InChI | InChI=1S/C7H10N2O3S/c10-6-5(7(11)12-9-6)4-3-13-2-1-8-4/h4,8,11H,1-3H2,(H,9,10) |
| InChIKey | RIDWNSYEASNJBQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |