C15H23NO2S — CID 162788352
5-pentyl-4-thiomorpholin-3-ylbenzene-1,3-diol (PubChem CID 162788352) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 5-pentyl-4-thiomorpholin-3-ylbenzene-1,3-diol.
| Compound Name | 5-pentyl-4-thiomorpholin-3-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 162788352 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-pentyl-4-thiomorpholin-3-ylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)cc(O)c1C1CSCCN1 |
| InChI | InChI=1S/C15H23NO2S/c1-2-3-4-5-11-8-12(17)9-14(18)15(11)13-10-19-7-6-16-13/h8-9,13,16-18H,2-7,10H2,1H3 |
| InChIKey | ZLOXCTKPGVUSLL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|