C16H23NO4 — CID 162788357
3-(2,4-dihydroxy-6-pentylphenyl)morpholine-4-carbaldehyde (PubChem CID 162788357) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-6-pentylphenyl)morpholine-4-carbaldehyde.
| Compound Name | 3-(2,4-dihydroxy-6-pentylphenyl)morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 162788357 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-(2,4-dihydroxy-6-pentylphenyl)morpholine-4-carbaldehyde |
| SMILES | CCCCCc1cc(O)cc(O)c1C1COCCN1C=O |
| InChI | InChI=1S/C16H23NO4/c1-2-3-4-5-12-8-13(19)9-15(20)16(12)14-10-21-7-6-17(14)11-18/h8-9,11,14,19-20H,2-7,10H2,1H3 |
| InChIKey | PVIDAEQOTPJCKG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|