2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid

C22H34O4 — CID 22665100

IUPAC2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid
SMILESCCCCCC/C=C/CCCCCCCc1cc(O)cc(O)c1C(=O)O
InChIInChI=1S/C22H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-19(23)17-20(24)21(18)22(25)26/h7-8,16-17,23-24H,2-6,9-15H2,1H3,(H,25,26)/b8-7+
InChIKeyACSAQPSTIMIXGH-BQYQJAHWSA-N
MW362.51 g/mol
LogP6.21
Rot. Bonds14

About 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid

2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid (PubChem CID 22665100) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid.

Molecular Properties

Compound Name2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid
PubChem CID22665100
Molecular FormulaC22H34O4
Molecular Weight362.51 g/mol
Exact Mass362.25
IUPAC Name2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid
SMILESCCCCCC/C=C/CCCCCCCc1cc(O)cc(O)c1C(=O)O
InChIInChI=1S/C22H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-19(23)17-20(24)21(18)22(25)26/h7-8,16-17,23-24H,2-6,9-15H2,1H3,(H,25,26)/b8-7+
InChIKeyACSAQPSTIMIXGH-BQYQJAHWSA-N
XLogP6.21
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds14
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.51
LogP ≤ 56.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid?
The IUPAC name of 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid (CID 22665100) is 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid.
What is the SMILES notation for 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid?
The canonical SMILES for 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid is CCCCCC/C=C/CCCCCCCc1cc(O)cc(O)c1C(=O)O.
What is the InChIKey of 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid?
The InChIKey is ACSAQPSTIMIXGH-BQYQJAHWSA-N. The full InChI is InChI=1S/C22H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-19(23)17-20(24)21(18)22(25)26/h7-8,16-17,23-24H,2-6,9-15H2,1H3,(H,25,26)/b8-7+.
What are the key properties of 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid?
2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid has a molecular weight of 362.51 g/mol, XLogP of 6.21, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid is sourced from PubChem (CID 22665100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).