C22H34O4 — CID 22665100
2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid (PubChem CID 22665100) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid.
| Compound Name | 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid |
|---|---|
| PubChem CID | 22665100 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2,4-dihydroxy-6-[(E)-pentadec-8-enyl]benzoic acid |
| SMILES | CCCCCC/C=C/CCCCCCCc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C22H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-19(23)17-20(24)21(18)22(25)26/h7-8,16-17,23-24H,2-6,9-15H2,1H3,(H,25,26)/b8-7+ |
| InChIKey | ACSAQPSTIMIXGH-BQYQJAHWSA-N |
| XLogP | 6.21 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|