C22H26O7 — CID 162956402
4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-heptyl-6-hydroxybenzoic acid (PubChem CID 162956402) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-heptyl-6-hydroxybenzoic acid.
| Compound Name | 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-heptyl-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 162956402 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-heptyl-6-hydroxybenzoic acid |
| SMILES | CCCCCCCc1cc(OC(=O)c2c(C)cc(O)cc2O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C22H26O7/c1-3-4-5-6-7-8-14-10-16(12-18(25)20(14)21(26)27)29-22(28)19-13(2)9-15(23)11-17(19)24/h9-12,23-25H,3-8H2,1-2H3,(H,26,27) |
| InChIKey | ROLBJWWAILRAHU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|