C25H30O8 — CID 163039577
2-hydroxy-4-[2-hydroxy-4-methoxy-6-(2-oxononyl)benzoyl]oxy-6-methylbenzoic acid (PubChem CID 163039577) has the molecular formula C25H30O8 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-hydroxy-4-[2-hydroxy-4-methoxy-6-(2-oxononyl)benzoyl]oxy-6-methylbenzoic acid.
| Compound Name | 2-hydroxy-4-[2-hydroxy-4-methoxy-6-(2-oxononyl)benzoyl]oxy-6-methylbenzoic acid |
|---|---|
| PubChem CID | 163039577 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-hydroxy-4-[2-hydroxy-4-methoxy-6-(2-oxononyl)benzoyl]oxy-6-methylbenzoic acid |
| SMILES | CCCCCCCC(=O)Cc1cc(OC)cc(O)c1C(=O)Oc1cc(C)c(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C25H30O8/c1-4-5-6-7-8-9-17(26)11-16-12-18(32-3)13-21(28)23(16)25(31)33-19-10-15(2)22(24(29)30)20(27)14-19/h10,12-14,27-28H,4-9,11H2,1-3H3,(H,29,30) |
| InChIKey | JUIOTWRVPCTDBX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|