C23H28O7 — CID 10621830
(4-butoxycarbonyl-3-hydroxy-5-methylphenyl) 2,4-dimethoxy-3,6-dimethylbenzoate (PubChem CID 10621830) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (4-butoxycarbonyl-3-hydroxy-5-methylphenyl) 2,4-dimethoxy-3,6-dimethylbenzoate.
| Compound Name | (4-butoxycarbonyl-3-hydroxy-5-methylphenyl) 2,4-dimethoxy-3,6-dimethylbenzoate |
|---|---|
| PubChem CID | 10621830 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (4-butoxycarbonyl-3-hydroxy-5-methylphenyl) 2,4-dimethoxy-3,6-dimethylbenzoate |
| SMILES | CCCCOC(=O)c1c(C)cc(OC(=O)c2c(C)cc(OC)c(C)c2OC)cc1O |
| InChI | InChI=1S/C23H28O7/c1-7-8-9-29-22(25)19-13(2)10-16(12-17(19)24)30-23(26)20-14(3)11-18(27-5)15(4)21(20)28-6/h10-12,24H,7-9H2,1-6H3 |
| InChIKey | OTCRGDUVKXPYEV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|