C18H18O7 — CID 10593660
(3-hydroxy-4-methoxycarbonyl-5-methylphenyl) 2,4-dihydroxy-3,6-dimethylbenzoate (PubChem CID 10593660) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is (3-hydroxy-4-methoxycarbonyl-5-methylphenyl) 2,4-dihydroxy-3,6-dimethylbenzoate.
| Compound Name | (3-hydroxy-4-methoxycarbonyl-5-methylphenyl) 2,4-dihydroxy-3,6-dimethylbenzoate |
|---|---|
| PubChem CID | 10593660 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (3-hydroxy-4-methoxycarbonyl-5-methylphenyl) 2,4-dihydroxy-3,6-dimethylbenzoate |
| SMILES | COC(=O)c1c(C)cc(OC(=O)c2c(C)cc(O)c(C)c2O)cc1O |
| InChI | InChI=1S/C18H18O7/c1-8-5-11(7-13(20)14(8)17(22)24-4)25-18(23)15-9(2)6-12(19)10(3)16(15)21/h5-7,19-21H,1-4H3 |
| InChIKey | XMJRFIFLGWMUTJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|