C20H22O7 — CID 10571428
(4-ethoxycarbonyl-3-hydroxy-5-methylphenyl) 4-hydroxy-2-methoxy-3,6-dimethylbenzoate (PubChem CID 10571428) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is (4-ethoxycarbonyl-3-hydroxy-5-methylphenyl) 4-hydroxy-2-methoxy-3,6-dimethylbenzoate.
| Compound Name | (4-ethoxycarbonyl-3-hydroxy-5-methylphenyl) 4-hydroxy-2-methoxy-3,6-dimethylbenzoate |
|---|---|
| PubChem CID | 10571428 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (4-ethoxycarbonyl-3-hydroxy-5-methylphenyl) 4-hydroxy-2-methoxy-3,6-dimethylbenzoate |
| SMILES | CCOC(=O)c1c(C)cc(OC(=O)c2c(C)cc(O)c(C)c2OC)cc1O |
| InChI | InChI=1S/C20H22O7/c1-6-26-19(23)16-10(2)7-13(9-15(16)22)27-20(24)17-11(3)8-14(21)12(4)18(17)25-5/h7-9,21-22H,6H2,1-5H3 |
| InChIKey | IGWQGZPMXFYJMA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|