About methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate
methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate (PubChem CID 161420499) has the molecular formula C21H26O5
and a molecular weight of 358.43 g/mol. Its IUPAC name is methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate.
Analyze methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate?
The IUPAC name of methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate (CID 161420499) is methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate.
What is the SMILES notation for methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate?
The canonical SMILES for methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate is COC(=O)c1c(C)cc(C)cc1C.COC(=O)c1c(C)cc(C)cc1O.
What is the InChIKey of methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate?
The InChIKey is VWQXZVKXSPXJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C10H12O3/c1-7-5-8(2)10(9(3)6-7)11(12)13-4;1-6-4-7(2)9(8(11)5-6)10(12)13-3/h5-6H,1-4H3;4-5,11H,1-3H3.
What are the key properties of methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate?
methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate has a molecular weight of 358.43 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-4,6-dimethylbenzoate;methyl 2,4,6-trimethylbenzoate is sourced from PubChem (CID 161420499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).