About 4-chloro-3,5-diheptylphenol
4-chloro-3,5-diheptylphenol (PubChem CID 67689522) has the molecular formula C20H33ClO
and a molecular weight of 324.94 g/mol. Its IUPAC name is 4-chloro-3,5-diheptylphenol.
Molecular Properties
| Compound Name | 4-chloro-3,5-diheptylphenol |
| PubChem CID | 67689522 |
| Molecular Formula | C20H33ClO |
| Molecular Weight | 324.94 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 4-chloro-3,5-diheptylphenol |
| SMILES | CCCCCCCc1cc(O)cc(CCCCCCC)c1Cl |
| InChI | InChI=1S/C20H33ClO/c1-3-5-7-9-11-13-17-15-19(22)16-18(20(17)21)14-12-10-8-6-4-2/h15-16,22H,3-14H2,1-2H3 |
| InChIKey | GNGVSMGLWYRCKJ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.94 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3,5-diheptylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5-diheptylphenol?
The IUPAC name of 4-chloro-3,5-diheptylphenol (CID 67689522) is 4-chloro-3,5-diheptylphenol.
What is the SMILES notation for 4-chloro-3,5-diheptylphenol?
The canonical SMILES for 4-chloro-3,5-diheptylphenol is CCCCCCCc1cc(O)cc(CCCCCCC)c1Cl.
What is the InChIKey of 4-chloro-3,5-diheptylphenol?
The InChIKey is GNGVSMGLWYRCKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33ClO/c1-3-5-7-9-11-13-17-15-19(22)16-18(20(17)21)14-12-10-8-6-4-2/h15-16,22H,3-14H2,1-2H3.
What are the key properties of 4-chloro-3,5-diheptylphenol?
4-chloro-3,5-diheptylphenol has a molecular weight of 324.94 g/mol, XLogP of 7.07, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-diheptylphenol is sourced from PubChem (CID 67689522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).