C12H14N2OS — CID 82290766
5-thiomorpholin-3-yl-1,3-dihydroindol-2-one (PubChem CID 82290766) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 5-thiomorpholin-3-yl-1,3-dihydroindol-2-one.
| Compound Name | 5-thiomorpholin-3-yl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82290766 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-thiomorpholin-3-yl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C3CSCCN3)ccc2N1 |
| InChI | InChI=1S/C12H14N2OS/c15-12-6-9-5-8(1-2-10(9)14-12)11-7-16-4-3-13-11/h1-2,5,11,13H,3-4,6-7H2,(H,14,15) |
| InChIKey | HZHYUBHQXYYZST-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |