C13H15NO — CID 23363851
5-cyclopentyl-1,3-dihydroindol-2-one (PubChem CID 23363851) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-cyclopentyl-1,3-dihydroindol-2-one.
| Compound Name | 5-cyclopentyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 23363851 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5-cyclopentyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C3CCCC3)ccc2N1 |
| InChI | InChI=1S/C13H15NO/c15-13-8-11-7-10(5-6-12(11)14-13)9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H,14,15) |
| InChIKey | PQLBGJSPPXKNMB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |