C13H15N3O2 — CID 116980989
5-(1-ethyl-2-oxoimidazolidin-4-yl)-1,3-dihydroindol-2-one (PubChem CID 116980989) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(1-ethyl-2-oxoimidazolidin-4-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-ethyl-2-oxoimidazolidin-4-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116980989 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-(1-ethyl-2-oxoimidazolidin-4-yl)-1,3-dihydroindol-2-one |
| SMILES | CCN1CC(c2ccc3c(c2)CC(=O)N3)NC1=O |
| InChI | InChI=1S/C13H15N3O2/c1-2-16-7-11(15-13(16)18)8-3-4-10-9(5-8)6-12(17)14-10/h3-5,11H,2,6-7H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | PJOZBQSJMKLROJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |