1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid

C14H16N2O3 — CID 117099453

IUPAC1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid
SMILESO=C1Cc2cc(N3CCCC(C(=O)O)C3)ccc2N1
InChIInChI=1S/C14H16N2O3/c17-13-7-10-6-11(3-4-12(10)15-13)16-5-1-2-9(8-16)14(18)19/h3-4,6,9H,1-2,5,7-8H2,(H,15,17)(H,18,19)
InChIKeyORCURXGGQDJUQS-UHFFFAOYSA-N
MW260.29 g/mol
LogP1.48
Rot. Bonds2

About 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid

1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid (PubChem CID 117099453) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid
PubChem CID117099453
Molecular FormulaC14H16N2O3
Molecular Weight260.29 g/mol
Exact Mass260.12
IUPAC Name1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid
SMILESO=C1Cc2cc(N3CCCC(C(=O)O)C3)ccc2N1
InChIInChI=1S/C14H16N2O3/c17-13-7-10-6-11(3-4-12(10)15-13)16-5-1-2-9(8-16)14(18)19/h3-4,6,9H,1-2,5,7-8H2,(H,15,17)(H,18,19)
InChIKeyORCURXGGQDJUQS-UHFFFAOYSA-N
XLogP1.48
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 51.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}

Analyze 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid (CID 117099453) is 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid is O=C1Cc2cc(N3CCCC(C(=O)O)C3)ccc2N1.
What is the InChIKey of 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid?
The InChIKey is ORCURXGGQDJUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c17-13-7-10-6-11(3-4-12(10)15-13)16-5-1-2-9(8-16)14(18)19/h3-4,6,9H,1-2,5,7-8H2,(H,15,17)(H,18,19).
What are the key properties of 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid?
1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid has a molecular weight of 260.29 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-oxo-1,3-dihydroindol-5-yl)piperidine-3-carboxylic acid is sourced from PubChem (CID 117099453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).