C12H13N3O2 — CID 82289120
5-(3-oxopiperazin-2-yl)-1,3-dihydroindol-2-one (PubChem CID 82289120) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(3-oxopiperazin-2-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(3-oxopiperazin-2-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82289120 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-(3-oxopiperazin-2-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C3NCCNC3=O)ccc2N1 |
| InChI | InChI=1S/C12H13N3O2/c16-10-6-8-5-7(1-2-9(8)15-10)11-12(17)14-4-3-13-11/h1-2,5,11,13H,3-4,6H2,(H,14,17)(H,15,16) |
| InChIKey | KKJYTZVTLQBXJM-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |