C8H6ClNO3S — CID 4962506
2-oxo-1,3-dihydroindole-5-sulfonyl chloride (PubChem CID 4962506) has the molecular formula C8H6ClNO3S and a molecular weight of 231.66 g/mol. Its IUPAC name is 2-oxo-1,3-dihydroindole-5-sulfonyl chloride.
| Compound Name | 2-oxo-1,3-dihydroindole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 4962506 |
| Molecular Formula | C8H6ClNO3S |
| Molecular Weight | 231.66 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 2-oxo-1,3-dihydroindole-5-sulfonyl chloride |
| SMILES | O=C1Cc2cc(S(=O)(=O)Cl)ccc2N1 |
| InChI | InChI=1S/C8H6ClNO3S/c9-14(12,13)6-1-2-7-5(3-6)4-8(11)10-7/h1-3H,4H2,(H,10,11) |
| InChIKey | FYBNVKMJOOYPGI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |