C12H14N2O3S — CID 129388520
5-[(3S)-pyrrolidin-3-yl]sulfonyl-1,3-dihydroindol-2-one (PubChem CID 129388520) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-[(3S)-pyrrolidin-3-yl]sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-[(3S)-pyrrolidin-3-yl]sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 129388520 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-[(3S)-pyrrolidin-3-yl]sulfonyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)[C@H]3CCNC3)ccc2N1 |
| InChI | InChI=1S/C12H14N2O3S/c15-12-6-8-5-9(1-2-11(8)14-12)18(16,17)10-3-4-13-7-10/h1-2,5,10,13H,3-4,6-7H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | VTWOJBJPRZBXPJ-JTQLQIEISA-N |
| XLogP | 0.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |