C10H12N2O4S — CID 60664960
N-methoxy-N-methyl-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 60664960) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-methoxy-N-methyl-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 60664960 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-methoxy-N-methyl-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | CON(C)S(=O)(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C10H12N2O4S/c1-12(16-2)17(14,15)8-3-4-9-7(5-8)6-10(13)11-9/h3-5H,6H2,1-2H3,(H,11,13) |
| InChIKey | WMMBWEKERFKWRS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|