C16H15NO3S — CID 18179950
5-(1-phenylethylsulfonyl)-1,3-dihydroindol-2-one (PubChem CID 18179950) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 5-(1-phenylethylsulfonyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-phenylethylsulfonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 18179950 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 5-(1-phenylethylsulfonyl)-1,3-dihydroindol-2-one |
| SMILES | CC(c1ccccc1)S(=O)(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C16H15NO3S/c1-11(12-5-3-2-4-6-12)21(19,20)14-7-8-15-13(9-14)10-16(18)17-15/h2-9,11H,10H2,1H3,(H,17,18) |
| InChIKey | MZLNZULPMMBHTN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |