C18H19NO2 — CID 61088892
5-(1-hydroxy-2-phenylbutyl)-1,3-dihydroindol-2-one (PubChem CID 61088892) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-(1-hydroxy-2-phenylbutyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-hydroxy-2-phenylbutyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61088892 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-(1-hydroxy-2-phenylbutyl)-1,3-dihydroindol-2-one |
| SMILES | CCC(c1ccccc1)C(O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C18H19NO2/c1-2-15(12-6-4-3-5-7-12)18(21)13-8-9-16-14(10-13)11-17(20)19-16/h3-10,15,18,21H,2,11H2,1H3,(H,19,20) |
| InChIKey | PMCUQQJKTVVRCS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |