C12H13NO5 — CID 171864289
methyl 2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-5-yl)propanoate (PubChem CID 171864289) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-5-yl)propanoate.
| Compound Name | methyl 2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-5-yl)propanoate |
|---|---|
| PubChem CID | 171864289 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | methyl 2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-5-yl)propanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C12H13NO5/c1-18-12(17)11(16)10(15)6-2-3-8-7(4-6)5-9(14)13-8/h2-4,10-11,15-16H,5H2,1H3,(H,13,14) |
| InChIKey | JTDVSELJUBANGQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |