C13H15NO5 — CID 171895821
methyl 3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-5-yl)butanoate (PubChem CID 171895821) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-5-yl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-5-yl)butanoate |
|---|---|
| PubChem CID | 171895821 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-5-yl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H15NO5/c1-19-12(17)6-10(15)13(18)7-2-3-9-8(4-7)5-11(16)14-9/h2-4,10,13,15,18H,5-6H2,1H3,(H,14,16) |
| InChIKey | VTYUFTYFZBKZMQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |