C13H16N2O3 — CID 116940124
methyl 3-amino-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propanoate (PubChem CID 116940124) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl 3-amino-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propanoate.
| Compound Name | methyl 3-amino-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propanoate |
|---|---|
| PubChem CID | 116940124 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl 3-amino-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)propanoate |
| SMILES | COC(=O)CC(N)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C13H16N2O3/c1-18-13(17)7-10(14)8-2-4-11-9(6-8)3-5-12(16)15-11/h2,4,6,10H,3,5,7,14H2,1H3,(H,15,16) |
| InChIKey | QGIBIKIWFZOJLE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |