C12H12ClNO3 — CID 116863121
ethyl 2-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)acetate (PubChem CID 116863121) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is ethyl 2-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)acetate.
| Compound Name | ethyl 2-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)acetate |
|---|---|
| PubChem CID | 116863121 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | ethyl 2-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)acetate |
| SMILES | CCOC(=O)C(Cl)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C12H12ClNO3/c1-2-17-12(16)11(13)7-3-4-9-8(5-7)6-10(15)14-9/h3-5,11H,2,6H2,1H3,(H,14,15) |
| InChIKey | OTYJBPANIVHDLX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|