C13H16BrNO — CID 61096734
5-(1-bromo-2,2-dimethylpropyl)-1,3-dihydroindol-2-one (PubChem CID 61096734) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 5-(1-bromo-2,2-dimethylpropyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-bromo-2,2-dimethylpropyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61096734 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 5-(1-bromo-2,2-dimethylpropyl)-1,3-dihydroindol-2-one |
| SMILES | CC(C)(C)C(Br)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H16BrNO/c1-13(2,3)12(14)8-4-5-10-9(6-8)7-11(16)15-10/h4-6,12H,7H2,1-3H3,(H,15,16) |
| InChIKey | OLRZOFYGIKXDEZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|