C17H14BrNO2 — CID 63744714
5-[bromo(1,3-dihydro-2-benzofuran-5-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 63744714) has the molecular formula C17H14BrNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-[bromo(1,3-dihydro-2-benzofuran-5-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo(1,3-dihydro-2-benzofuran-5-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63744714 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 5-[bromo(1,3-dihydro-2-benzofuran-5-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)c3ccc4c(c3)COC4)ccc2N1 |
| InChI | InChI=1S/C17H14BrNO2/c18-17(10-1-2-12-8-21-9-14(12)6-10)11-3-4-15-13(5-11)7-16(20)19-15/h1-6,17H,7-9H2,(H,19,20) |
| InChIKey | VXNNSAIVKYKDJU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|