C15H21N3O — CID 115117886
5-[(2-aminocyclohexyl)-methylamino]-1,3-dihydroindol-2-one (PubChem CID 115117886) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-[(2-aminocyclohexyl)-methylamino]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(2-aminocyclohexyl)-methylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115117886 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 5-[(2-aminocyclohexyl)-methylamino]-1,3-dihydroindol-2-one |
| SMILES | CN(c1ccc2c(c1)CC(=O)N2)C1CCCCC1N |
| InChI | InChI=1S/C15H21N3O/c1-18(14-5-3-2-4-12(14)16)11-6-7-13-10(8-11)9-15(19)17-13/h6-8,12,14H,2-5,9,16H2,1H3,(H,17,19) |
| InChIKey | GWBFHIWOTYXFIK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |