C7H11N3 — CID 68704974
1,2,3,3a,4,5-hexahydroimidazo[4,5-b]azepine (PubChem CID 68704974) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydroimidazo[4,5-b]azepine.
| Compound Name | 1,2,3,3a,4,5-hexahydroimidazo[4,5-b]azepine |
|---|---|
| PubChem CID | 68704974 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydroimidazo[4,5-b]azepine |
| SMILES | C1=CCNC2NCNC2=C1 |
| InChI | InChI=1S/C7H11N3/c1-2-4-8-7-6(3-1)9-5-10-7/h1-3,7-10H,4-5H2 |
| InChIKey | KOCDCZGQSALNPK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |