C10H16N2 — CID 172719182
2,3,4,5,5a,6-hexahydro-1H-1-benzazepin-3-amine (PubChem CID 172719182) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,3,4,5,5a,6-hexahydro-1H-1-benzazepin-3-amine.
| Compound Name | 2,3,4,5,5a,6-hexahydro-1H-1-benzazepin-3-amine |
|---|---|
| PubChem CID | 172719182 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2,3,4,5,5a,6-hexahydro-1H-1-benzazepin-3-amine |
| SMILES | NC1CCC2CC=CC=C2NC1 |
| InChI | InChI=1S/C10H16N2/c11-9-6-5-8-3-1-2-4-10(8)12-7-9/h1-2,4,8-9,12H,3,5-7,11H2 |
| InChIKey | GGRZHGDAIDLCNB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |