C20H28Cl2 — CID 172863415
1-[2-(2,3,3a,4-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,4-tetrahydro-1H-indene;dihydrochloride (PubChem CID 172863415) has the molecular formula C20H28Cl2 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1-[2-(2,3,3a,4-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,4-tetrahydro-1H-indene;dihydrochloride.
| Compound Name | 1-[2-(2,3,3a,4-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,4-tetrahydro-1H-indene;dihydrochloride |
|---|---|
| PubChem CID | 172863415 |
| Molecular Formula | C20H28Cl2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[2-(2,3,3a,4-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,4-tetrahydro-1H-indene;dihydrochloride |
| SMILES | C1=CCC2CCC(CCC3CCC4CC=CC=C43)C2=C1.Cl.Cl |
| InChI | InChI=1S/C20H26.2ClH/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;/h1-4,7-8,15-18H,5-6,9-14H2;2*1H |
| InChIKey | ZQWUUWOSSRUQPE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |