C13H16O2 — CID 150441183
2,3,3a,4-tetrahydro-1H-inden-1-yl 2-methylprop-2-enoate (PubChem CID 150441183) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-inden-1-yl 2-methylprop-2-enoate.
| Compound Name | 2,3,3a,4-tetrahydro-1H-inden-1-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150441183 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-inden-1-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC2CC=CC=C21 |
| InChI | InChI=1S/C13H16O2/c1-9(2)13(14)15-12-8-7-10-5-3-4-6-11(10)12/h3-4,6,10,12H,1,5,7-8H2,2H3 |
| InChIKey | HLUOBNNSXVJZJE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|