C11H12O3 — CID 90261973
5,6-dihydro-4H-cyclopenta[b]furan-6-yl 2-methylprop-2-enoate (PubChem CID 90261973) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[b]furan-6-yl 2-methylprop-2-enoate.
| Compound Name | 5,6-dihydro-4H-cyclopenta[b]furan-6-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90261973 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5,6-dihydro-4H-cyclopenta[b]furan-6-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCc2ccoc21 |
| InChI | InChI=1S/C11H12O3/c1-7(2)11(12)14-9-4-3-8-5-6-13-10(8)9/h5-6,9H,1,3-4H2,2H3 |
| InChIKey | ICKHANYPAMZJQK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|