C10H15NO — CID 141374768
2-methyl-3,4,4a,5-tetrahydro-1H-isoquinolin-1-ol (PubChem CID 141374768) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-methyl-3,4,4a,5-tetrahydro-1H-isoquinolin-1-ol.
| Compound Name | 2-methyl-3,4,4a,5-tetrahydro-1H-isoquinolin-1-ol |
|---|---|
| PubChem CID | 141374768 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-methyl-3,4,4a,5-tetrahydro-1H-isoquinolin-1-ol |
| SMILES | CN1CCC2CC=CC=C2C1O |
| InChI | InChI=1S/C10H15NO/c1-11-7-6-8-4-2-3-5-9(8)10(11)12/h2-3,5,8,10,12H,4,6-7H2,1H3 |
| InChIKey | UCTIJWYBZCKBOH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |