C9H12BrN — CID 150478285
2-bromo-3,4,4a,5-tetrahydro-1H-isoquinoline (PubChem CID 150478285) has the molecular formula C9H12BrN and a molecular weight of 214.11 g/mol. Its IUPAC name is 2-bromo-3,4,4a,5-tetrahydro-1H-isoquinoline.
| Compound Name | 2-bromo-3,4,4a,5-tetrahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 150478285 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 2-bromo-3,4,4a,5-tetrahydro-1H-isoquinoline |
| SMILES | BrN1CCC2CC=CC=C2C1 |
| InChI | InChI=1S/C9H12BrN/c10-11-6-5-8-3-1-2-4-9(8)7-11/h1-2,4,8H,3,5-7H2 |
| InChIKey | HTGOBRKCBRZBOQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|