C9H12N2O — CID 153489139
1,3,3a,4-tetrahydroisoindole-2-carboxamide (PubChem CID 153489139) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,3,3a,4-tetrahydroisoindole-2-carboxamide.
| Compound Name | 1,3,3a,4-tetrahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 153489139 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,3,3a,4-tetrahydroisoindole-2-carboxamide |
| SMILES | NC(=O)N1CC2=CC=CCC2C1 |
| InChI | InChI=1S/C9H12N2O/c10-9(12)11-5-7-3-1-2-4-8(7)6-11/h1-3,8H,4-6H2,(H2,10,12) |
| InChIKey | PXNYQNGFZIVKIK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |