C9H11NOS — CID 140615269
1,3,3a,4-tetrahydro-2-benzothiophene-1-carboxamide (PubChem CID 140615269) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 1,3,3a,4-tetrahydro-2-benzothiophene-1-carboxamide.
| Compound Name | 1,3,3a,4-tetrahydro-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 140615269 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 1,3,3a,4-tetrahydro-2-benzothiophene-1-carboxamide |
| SMILES | NC(=O)C1SCC2CC=CC=C21 |
| InChI | InChI=1S/C9H11NOS/c10-9(11)8-7-4-2-1-3-6(7)5-12-8/h1-2,4,6,8H,3,5H2,(H2,10,11) |
| InChIKey | AVZZATMAOTUMFF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |