C8H11NO — CID 55289117
6-methylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 55289117) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 6-methylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 6-methylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 55289117 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 6-methylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CC1CC=CC=C1C(N)=O |
| InChI | InChI=1S/C8H11NO/c1-6-4-2-3-5-7(6)8(9)10/h2-3,5-6H,4H2,1H3,(H2,9,10) |
| InChIKey | NJWMKAGYUMXCDC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |