About 6-methylcyclohexa-1,3-diene-1-carboxamide
6-methylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 55289117) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 6-methylcyclohexa-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | 6-methylcyclohexa-1,3-diene-1-carboxamide |
| PubChem CID | 55289117 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 6-methylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CC1CC=CC=C1C(N)=O |
| InChI | InChI=1S/C8H11NO/c1-6-4-2-3-5-7(6)8(9)10/h2-3,5-6H,4H2,1H3,(H2,9,10) |
| InChIKey | NJWMKAGYUMXCDC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methylcyclohexa-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylcyclohexa-1,3-diene-1-carboxamide?
The IUPAC name of 6-methylcyclohexa-1,3-diene-1-carboxamide (CID 55289117) is 6-methylcyclohexa-1,3-diene-1-carboxamide.
What is the SMILES notation for 6-methylcyclohexa-1,3-diene-1-carboxamide?
The canonical SMILES for 6-methylcyclohexa-1,3-diene-1-carboxamide is CC1CC=CC=C1C(N)=O.
What is the InChIKey of 6-methylcyclohexa-1,3-diene-1-carboxamide?
The InChIKey is NJWMKAGYUMXCDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-6-4-2-3-5-7(6)8(9)10/h2-3,5-6H,4H2,1H3,(H2,9,10).
What are the key properties of 6-methylcyclohexa-1,3-diene-1-carboxamide?
6-methylcyclohexa-1,3-diene-1-carboxamide has a molecular weight of 137.18 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylcyclohexa-1,3-diene-1-carboxamide is sourced from PubChem (CID 55289117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).